C37H52N6O2 — CID 172988285
2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-5-piperidin-1-ylbenzamide;methane (PubChem CID 172988285) has the molecular formula C37H52N6O2 and a molecular weight of 612.86 g/mol. Its IUPAC name is 2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-5-piperidin-1-ylbenzamide;methane.
| Compound Name | 2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-5-piperidin-1-ylbenzamide;methane |
|---|---|
| PubChem CID | 172988285 |
| Molecular Formula | C37H52N6O2 |
| Molecular Weight | 612.86 g/mol |
| Exact Mass | 612.42 |
| IUPAC Name | 2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-5-piperidin-1-ylbenzamide;methane |
| SMILES | C.CCN(CC)CCN(C)Cc1cccc(C(=O)Nc2ccc(N3CCCCC3)cc2C(=O)N/N=C/c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C36H48N6O2.CH4/c1-6-41(7-2)21-20-40(5)26-30-12-11-13-31(23-30)35(43)38-34-17-16-32(42-18-9-8-10-19-42)24-33(34)36(44)39-37-25-29-15-14-27(3)28(4)22-29;/h11-17,22-25H,6-10,18-21,26H2,1-5H3,(H,38,43)(H,39,44);1H4/b37-25+; |
| InChIKey | OZNUOBRZCUSZMS-XFQLUCEVSA-N |
| XLogP | 6.72 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.86 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|