C35H47N5O5 — CID 66638833
2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-5-[2-(2-methoxyethoxy)ethoxy]-N-[(4-methylphenyl)methylideneamino]benzamide (PubChem CID 66638833) has the molecular formula C35H47N5O5 and a molecular weight of 617.79 g/mol. Its IUPAC name is 2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-5-[2-(2-methoxyethoxy)ethoxy]-N-[(4-methylphenyl)methylideneamino]benzamide.
| Compound Name | 2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-5-[2-(2-methoxyethoxy)ethoxy]-N-[(4-methylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 66638833 |
| Molecular Formula | C35H47N5O5 |
| Molecular Weight | 617.79 g/mol |
| Exact Mass | 617.36 |
| IUPAC Name | 2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-5-[2-(2-methoxyethoxy)ethoxy]-N-[(4-methylphenyl)methylideneamino]benzamide |
| SMILES | CCN(CC)CCN(C)Cc1cccc(C(=O)Nc2ccc(OCCOCCOC)cc2C(=O)NN=Cc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C35H47N5O5/c1-6-40(7-2)18-17-39(4)26-29-9-8-10-30(23-29)34(41)37-33-16-15-31(45-22-21-44-20-19-43-5)24-32(33)35(42)38-36-25-28-13-11-27(3)12-14-28/h8-16,23-25H,6-7,17-22,26H2,1-5H3,(H,37,41)(H,38,42) |
| InChIKey | PFWOTNRPLLRSDJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.79 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|