C35H43ClF3N5O5 — CID 66638639
N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-5-[2-(2-methoxyethoxy)ethoxy]benzamide (PubChem CID 66638639) has the molecular formula C35H43ClF3N5O5 and a molecular weight of 706.21 g/mol. Its IUPAC name is N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-5-[2-(2-methoxyethoxy)ethoxy]benzamide.
| Compound Name | N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-5-[2-(2-methoxyethoxy)ethoxy]benzamide |
|---|---|
| PubChem CID | 66638639 |
| Molecular Formula | C35H43ClF3N5O5 |
| Molecular Weight | 706.21 g/mol |
| Exact Mass | 705.29 |
| IUPAC Name | N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[[3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoyl]amino]-5-[2-(2-methoxyethoxy)ethoxy]benzamide |
| SMILES | CCN(CC)CCN(C)Cc1cccc(C(=O)Nc2ccc(OCCOCCOC)cc2C(=O)NN=Cc2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C35H43ClF3N5O5/c1-5-44(6-2)15-14-43(3)24-26-8-7-9-27(20-26)33(45)41-32-13-11-28(49-19-18-48-17-16-47-4)22-29(32)34(46)42-40-23-25-10-12-31(36)30(21-25)35(37,38)39/h7-13,20-23H,5-6,14-19,24H2,1-4H3,(H,41,45)(H,42,46) |
| InChIKey | JDZAUQGELMVGFQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.21 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|