C33H42ClN5O5 — CID 66638503
2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-5-chloro-N-[[4-[3-(dimethylamino)propoxy]phenyl]methylideneamino]benzamide (PubChem CID 66638503) has the molecular formula C33H42ClN5O5 and a molecular weight of 624.18 g/mol. Its IUPAC name is 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-5-chloro-N-[[4-[3-(dimethylamino)propoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-5-chloro-N-[[4-[3-(dimethylamino)propoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 66638503 |
| Molecular Formula | C33H42ClN5O5 |
| Molecular Weight | 624.18 g/mol |
| Exact Mass | 623.29 |
| IUPAC Name | 2-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-5-chloro-N-[[4-[3-(dimethylamino)propoxy]phenyl]methylideneamino]benzamide |
| SMILES | CC(O)CN(Cc1cccc(C(=O)Nc2ccc(Cl)cc2C(=O)NN=Cc2ccc(OCCCN(C)C)cc2)c1)CC(C)O |
| InChI | InChI=1S/C33H42ClN5O5/c1-23(40)20-39(21-24(2)41)22-26-7-5-8-27(17-26)32(42)36-31-14-11-28(34)18-30(31)33(43)37-35-19-25-9-12-29(13-10-25)44-16-6-15-38(3)4/h5,7-14,17-19,23-24,40-41H,6,15-16,20-22H2,1-4H3,(H,36,42)(H,37,43) |
| InChIKey | OJILUEHLNKLDEB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.18 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|