C34H38N4O4 — CID 66638875
3-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(3,4-dimethylphenyl)methylideneamino]naphthalene-2-carboxamide (PubChem CID 66638875) has the molecular formula C34H38N4O4 and a molecular weight of 566.70 g/mol. Its IUPAC name is 3-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(3,4-dimethylphenyl)methylideneamino]naphthalene-2-carboxamide.
| Compound Name | 3-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(3,4-dimethylphenyl)methylideneamino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 66638875 |
| Molecular Formula | C34H38N4O4 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | 3-[[3-[[bis(2-hydroxypropyl)amino]methyl]benzoyl]amino]-N-[(3,4-dimethylphenyl)methylideneamino]naphthalene-2-carboxamide |
| SMILES | Cc1ccc(C=NNC(=O)c2cc3ccccc3cc2NC(=O)c2cccc(CN(CC(C)O)CC(C)O)c2)cc1C |
| InChI | InChI=1S/C34H38N4O4/c1-22-12-13-26(14-23(22)2)18-35-37-34(42)31-16-28-9-5-6-10-29(28)17-32(31)36-33(41)30-11-7-8-27(15-30)21-38(19-24(3)39)20-25(4)40/h5-18,24-25,39-40H,19-21H2,1-4H3,(H,36,41)(H,37,42) |
| InChIKey | ACNLJBCONYQTIT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|