C23H20FN3O2 — CID 23107274
N-[(E)-(3,4-dimethylphenyl)methylideneamino]-2-[(3-fluorobenzoyl)amino]benzamide (PubChem CID 23107274) has the molecular formula C23H20FN3O2 and a molecular weight of 389.43 g/mol. Its IUPAC name is N-[(E)-(3,4-dimethylphenyl)methylideneamino]-2-[(3-fluorobenzoyl)amino]benzamide.
| Compound Name | N-[(E)-(3,4-dimethylphenyl)methylideneamino]-2-[(3-fluorobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 23107274 |
| Molecular Formula | C23H20FN3O2 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-[(E)-(3,4-dimethylphenyl)methylideneamino]-2-[(3-fluorobenzoyl)amino]benzamide |
| SMILES | Cc1ccc(/C=N/NC(=O)c2ccccc2NC(=O)c2cccc(F)c2)cc1C |
| InChI | InChI=1S/C23H20FN3O2/c1-15-10-11-17(12-16(15)2)14-25-27-23(29)20-8-3-4-9-21(20)26-22(28)18-6-5-7-19(24)13-18/h3-14H,1-2H3,(H,26,28)(H,27,29)/b25-14+ |
| InChIKey | SMULNQYINABUKE-AFUMVMLFSA-N |
| XLogP | 4.46 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|