C26H27N3O4 — CID 23107625
2-[(3,4-dimethoxybenzoyl)amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-5-methylbenzamide (PubChem CID 23107625) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-[(3,4-dimethoxybenzoyl)amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-5-methylbenzamide.
| Compound Name | 2-[(3,4-dimethoxybenzoyl)amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-5-methylbenzamide |
|---|---|
| PubChem CID | 23107625 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 2-[(3,4-dimethoxybenzoyl)amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-5-methylbenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(C)cc2C(=O)N/N=C/c2ccc(C)c(C)c2)cc1OC |
| InChI | InChI=1S/C26H27N3O4/c1-16-6-10-22(28-25(30)20-9-11-23(32-4)24(14-20)33-5)21(12-16)26(31)29-27-15-19-8-7-17(2)18(3)13-19/h6-15H,1-5H3,(H,28,30)(H,29,31)/b27-15+ |
| InChIKey | GXCJIMAFCNABQD-JFLMPSFJSA-N |
| XLogP | 4.65 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|