C22H19BrN4O4 — CID 66637300
N-[4-bromo-2-[(pyridin-3-ylmethylideneamino)carbamoyl]phenyl]-3,4-dimethoxybenzamide (PubChem CID 66637300) has the molecular formula C22H19BrN4O4 and a molecular weight of 483.32 g/mol. Its IUPAC name is N-[4-bromo-2-[(pyridin-3-ylmethylideneamino)carbamoyl]phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-bromo-2-[(pyridin-3-ylmethylideneamino)carbamoyl]phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 66637300 |
| Molecular Formula | C22H19BrN4O4 |
| Molecular Weight | 483.32 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | N-[4-bromo-2-[(pyridin-3-ylmethylideneamino)carbamoyl]phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(Br)cc2C(=O)NN=Cc2cccnc2)cc1OC |
| InChI | InChI=1S/C22H19BrN4O4/c1-30-19-8-5-15(10-20(19)31-2)21(28)26-18-7-6-16(23)11-17(18)22(29)27-25-13-14-4-3-9-24-12-14/h3-13H,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | TYWGVRFNIMBMQV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|