C22H18BrNO4 — CID 21204048
N-(2-benzoyl-4-bromophenyl)-3,4-dimethoxybenzamide (PubChem CID 21204048) has the molecular formula C22H18BrNO4 and a molecular weight of 440.29 g/mol. Its IUPAC name is N-(2-benzoyl-4-bromophenyl)-3,4-dimethoxybenzamide.
| Compound Name | N-(2-benzoyl-4-bromophenyl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 21204048 |
| Molecular Formula | C22H18BrNO4 |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | N-(2-benzoyl-4-bromophenyl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(Br)cc2C(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C22H18BrNO4/c1-27-19-11-8-15(12-20(19)28-2)22(26)24-18-10-9-16(23)13-17(18)21(25)14-6-4-3-5-7-14/h3-13H,1-2H3,(H,24,26) |
| InChIKey | XCJXTRSCNROHIZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |