C31H37N3O5 — CID 136648311
N-[2-[[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]-3,4-dimethoxybenzamide (PubChem CID 136648311) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is N-[2-[[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 136648311 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | N-[2-[[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2C(=O)NN=Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1OC |
| InChI | InChI=1S/C31H37N3O5/c1-30(2,3)22-15-19(16-23(27(22)35)31(4,5)6)18-32-34-29(37)21-11-9-10-12-24(21)33-28(36)20-13-14-25(38-7)26(17-20)39-8/h9-18,35H,1-8H3,(H,33,36)(H,34,37) |
| InChIKey | MNROOOFRQTUFJQ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|