C23H20IN3O5 — CID 136914355
N-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-[(4-methoxybenzoyl)amino]benzamide (PubChem CID 136914355) has the molecular formula C23H20IN3O5 and a molecular weight of 545.33 g/mol. Its IUPAC name is N-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-[(4-methoxybenzoyl)amino]benzamide.
| Compound Name | N-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-[(4-methoxybenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 136914355 |
| Molecular Formula | C23H20IN3O5 |
| Molecular Weight | 545.33 g/mol |
| Exact Mass | 545.04 |
| IUPAC Name | N-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-[(4-methoxybenzoyl)amino]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2C(=O)NN=Cc2cc(I)c(O)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H20IN3O5/c1-31-16-9-7-15(8-10-16)22(29)26-19-6-4-3-5-17(19)23(30)27-25-13-14-11-18(24)21(28)20(12-14)32-2/h3-13,28H,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | SGSRGGGVJZMQIE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|