C23H20IN3O4 — CID 3395997
N-[2-[[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]carbamoyl]phenyl]-2-methylbenzamide (PubChem CID 3395997) has the molecular formula C23H20IN3O4 and a molecular weight of 529.33 g/mol. Its IUPAC name is N-[2-[[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]carbamoyl]phenyl]-2-methylbenzamide.
| Compound Name | N-[2-[[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]carbamoyl]phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 3395997 |
| Molecular Formula | C23H20IN3O4 |
| Molecular Weight | 529.33 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | N-[2-[[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]carbamoyl]phenyl]-2-methylbenzamide |
| SMILES | COc1cc(C=NNC(=O)c2ccccc2NC(=O)c2ccccc2C)cc(I)c1O |
| InChI | InChI=1S/C23H20IN3O4/c1-14-7-3-4-8-16(14)22(29)26-19-10-6-5-9-17(19)23(30)27-25-13-15-11-18(24)21(28)20(12-15)31-2/h3-13,28H,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | UWCZVMDUFZWGFC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.33 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|