C15H12I2N2O3 — CID 137117330
N-[(Z)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]-2-methoxybenzamide (PubChem CID 137117330) has the molecular formula C15H12I2N2O3 and a molecular weight of 522.08 g/mol. Its IUPAC name is N-[(Z)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]-2-methoxybenzamide.
| Compound Name | N-[(Z)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]-2-methoxybenzamide |
|---|---|
| PubChem CID | 137117330 |
| Molecular Formula | C15H12I2N2O3 |
| Molecular Weight | 522.08 g/mol |
| Exact Mass | 521.89 |
| IUPAC Name | N-[(Z)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)N/N=C\c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C15H12I2N2O3/c1-22-13-5-3-2-4-10(13)15(21)19-18-8-9-6-11(16)14(20)12(17)7-9/h2-8,20H,1H3,(H,19,21)/b18-8- |
| InChIKey | USKBXJCPDPXKBB-LSCVHKIXSA-N |
| XLogP | 3.37 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.08 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|