C18H18IN3O5 — CID 3473434
N'-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-N-(4-methoxyphenyl)propanediamide (PubChem CID 3473434) has the molecular formula C18H18IN3O5 and a molecular weight of 483.26 g/mol. Its IUPAC name is N'-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-N-(4-methoxyphenyl)propanediamide.
| Compound Name | N'-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-N-(4-methoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 3473434 |
| Molecular Formula | C18H18IN3O5 |
| Molecular Weight | 483.26 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | N'-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-N-(4-methoxyphenyl)propanediamide |
| SMILES | COc1ccc(NC(=O)CC(=O)NN=Cc2cc(I)c(O)c(OC)c2)cc1 |
| InChI | InChI=1S/C18H18IN3O5/c1-26-13-5-3-12(4-6-13)21-16(23)9-17(24)22-20-10-11-7-14(19)18(25)15(8-11)27-2/h3-8,10,25H,9H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | SPOHNRHHFPDQQP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|