C18H17ClIN3O4 — CID 3509912
N-(4-chlorophenyl)-N'-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]propanediamide (PubChem CID 3509912) has the molecular formula C18H17ClIN3O4 and a molecular weight of 501.71 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N'-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]propanediamide.
| Compound Name | N-(4-chlorophenyl)-N'-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 3509912 |
| Molecular Formula | C18H17ClIN3O4 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.00 |
| IUPAC Name | N-(4-chlorophenyl)-N'-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]propanediamide |
| SMILES | CCOc1cc(C=NNC(=O)CC(=O)Nc2ccc(Cl)cc2)cc(I)c1O |
| InChI | InChI=1S/C18H17ClIN3O4/c1-2-27-15-8-11(7-14(20)18(15)26)10-21-23-17(25)9-16(24)22-13-5-3-12(19)4-6-13/h3-8,10,26H,2,9H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | SGCQJVBZNMSDLW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|