C19H21IN2O3 — CID 137180791
N-[(E)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2-(4-ethylphenyl)acetamide (PubChem CID 137180791) has the molecular formula C19H21IN2O3 and a molecular weight of 452.29 g/mol. Its IUPAC name is N-[(E)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2-(4-ethylphenyl)acetamide.
| Compound Name | N-[(E)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 137180791 |
| Molecular Formula | C19H21IN2O3 |
| Molecular Weight | 452.29 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | N-[(E)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2-(4-ethylphenyl)acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)Cc2ccc(CC)cc2)cc(I)c1O |
| InChI | InChI=1S/C19H21IN2O3/c1-3-13-5-7-14(8-6-13)11-18(23)22-21-12-15-9-16(20)19(24)17(10-15)25-4-2/h5-10,12,24H,3-4,11H2,1-2H3,(H,22,23)/b21-12+ |
| InChIKey | KCYDBQKWVXJCAD-CIAFOILYSA-N |
| XLogP | 3.65 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|