C14H16IN3O4 — CID 137048193
N-cyclopropyl-N'-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]oxamide (PubChem CID 137048193) has the molecular formula C14H16IN3O4 and a molecular weight of 417.20 g/mol. Its IUPAC name is N-cyclopropyl-N'-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]oxamide.
| Compound Name | N-cyclopropyl-N'-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 137048193 |
| Molecular Formula | C14H16IN3O4 |
| Molecular Weight | 417.20 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | N-cyclopropyl-N'-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NC2CC2)cc(I)c1O |
| InChI | InChI=1S/C14H16IN3O4/c1-2-22-11-6-8(5-10(15)12(11)19)7-16-18-14(21)13(20)17-9-3-4-9/h5-7,9,19H,2-4H2,1H3,(H,17,20)(H,18,21)/b16-7- |
| InChIKey | CWIOLUSJGYSZFZ-APSNUPSMSA-N |
| XLogP | 1.12 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|