C22H26IN3O7 — CID 136676413
N'-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-N-[2-(3,4,5-trimethoxyphenyl)ethyl]oxamide (PubChem CID 136676413) has the molecular formula C22H26IN3O7 and a molecular weight of 571.37 g/mol. Its IUPAC name is N'-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-N-[2-(3,4,5-trimethoxyphenyl)ethyl]oxamide.
| Compound Name | N'-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-N-[2-(3,4,5-trimethoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 136676413 |
| Molecular Formula | C22H26IN3O7 |
| Molecular Weight | 571.37 g/mol |
| Exact Mass | 571.08 |
| IUPAC Name | N'-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-N-[2-(3,4,5-trimethoxyphenyl)ethyl]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NCCc2cc(OC)c(OC)c(OC)c2)cc(I)c1O |
| InChI | InChI=1S/C22H26IN3O7/c1-5-33-16-11-14(8-15(23)19(16)27)12-25-26-22(29)21(28)24-7-6-13-9-17(30-2)20(32-4)18(10-13)31-3/h8-12,27H,5-7H2,1-4H3,(H,24,28)(H,26,29)/b25-12- |
| InChIKey | CTVJUIFXJJLRBA-ROTLSHHCSA-N |
| XLogP | 2.23 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|