C12H14IN3O4 — CID 137059381
N-ethyl-N'-[(Z)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]oxamide (PubChem CID 137059381) has the molecular formula C12H14IN3O4 and a molecular weight of 391.17 g/mol. Its IUPAC name is N-ethyl-N'-[(Z)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-ethyl-N'-[(Z)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 137059381 |
| Molecular Formula | C12H14IN3O4 |
| Molecular Weight | 391.17 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | N-ethyl-N'-[(Z)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]oxamide |
| SMILES | CCNC(=O)C(=O)N/N=C\c1cc(I)c(O)c(OC)c1 |
| InChI | InChI=1S/C12H14IN3O4/c1-3-14-11(18)12(19)16-15-6-7-4-8(13)10(17)9(5-7)20-2/h4-6,17H,3H2,1-2H3,(H,14,18)(H,16,19)/b15-6- |
| InChIKey | WQLJAAFGHCHRMG-UUASQNMZSA-N |
| XLogP | 0.59 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.17 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|