C15H21N3O4 — CID 8989083
N-ethyl-N'-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]oxamide (PubChem CID 8989083) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-ethyl-N'-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-ethyl-N'-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 8989083 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | N-ethyl-N'-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]oxamide |
| SMILES | CCCOc1ccc(/C=N\NC(=O)C(=O)NCC)cc1OC |
| InChI | InChI=1S/C15H21N3O4/c1-4-8-22-12-7-6-11(9-13(12)21-3)10-17-18-15(20)14(19)16-5-2/h6-7,9-10H,4-5,8H2,1-3H3,(H,16,19)(H,18,20)/b17-10- |
| InChIKey | OVNYNPIHTGOXMH-YVLHZVERSA-N |
| XLogP | 1.07 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|