C14H20N2O4 — CID 9075566
methyl N-[(Z)-(4-butoxy-3-methoxyphenyl)methylideneamino]carbamate (PubChem CID 9075566) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl N-[(Z)-(4-butoxy-3-methoxyphenyl)methylideneamino]carbamate.
| Compound Name | methyl N-[(Z)-(4-butoxy-3-methoxyphenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 9075566 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | methyl N-[(Z)-(4-butoxy-3-methoxyphenyl)methylideneamino]carbamate |
| SMILES | CCCCOc1ccc(/C=N\NC(=O)OC)cc1OC |
| InChI | InChI=1S/C14H20N2O4/c1-4-5-8-20-12-7-6-11(9-13(12)18-2)10-15-16-14(17)19-3/h6-7,9-10H,4-5,8H2,1-3H3,(H,16,17)/b15-10- |
| InChIKey | NAKWGRQUKLPKNJ-GDNBJRDFSA-N |
| XLogP | 2.56 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|