C23H22F3IN4O5 — CID 126158329
N-cyclopropyl-N'-[(Z)-[3-ethoxy-5-iodo-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126158329) has the molecular formula C23H22F3IN4O5 and a molecular weight of 618.35 g/mol. Its IUPAC name is N-cyclopropyl-N'-[(Z)-[3-ethoxy-5-iodo-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-cyclopropyl-N'-[(Z)-[3-ethoxy-5-iodo-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126158329 |
| Molecular Formula | C23H22F3IN4O5 |
| Molecular Weight | 618.35 g/mol |
| Exact Mass | 618.06 |
| IUPAC Name | N-cyclopropyl-N'-[(Z)-[3-ethoxy-5-iodo-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NC2CC2)cc(I)c1OCC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H22F3IN4O5/c1-2-35-18-10-13(11-28-31-22(34)21(33)29-14-7-8-14)9-16(27)20(18)36-12-19(32)30-17-6-4-3-5-15(17)23(24,25)26/h3-6,9-11,14H,2,7-8,12H2,1H3,(H,29,33)(H,30,32)(H,31,34)/b28-11- |
| InChIKey | IUJVINGXBXCJDE-FXMZOFOKSA-N |
| XLogP | 3.45 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|