C26H22F4N4O5 — CID 126158937
N'-[(Z)-[3-ethoxy-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-(4-fluorophenyl)oxamide (PubChem CID 126158937) has the molecular formula C26H22F4N4O5 and a molecular weight of 546.48 g/mol. Its IUPAC name is N'-[(Z)-[3-ethoxy-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-(4-fluorophenyl)oxamide.
| Compound Name | N'-[(Z)-[3-ethoxy-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-(4-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 126158937 |
| Molecular Formula | C26H22F4N4O5 |
| Molecular Weight | 546.48 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | N'-[(Z)-[3-ethoxy-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-(4-fluorophenyl)oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)Nc2ccc(F)cc2)ccc1OCC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C26H22F4N4O5/c1-2-38-22-13-16(14-31-34-25(37)24(36)32-18-10-8-17(27)9-11-18)7-12-21(22)39-15-23(35)33-20-6-4-3-5-19(20)26(28,29)30/h3-14H,2,15H2,1H3,(H,32,36)(H,33,35)(H,34,37)/b31-14- |
| InChIKey | KVOUJZMLSCXESJ-AQLQTECXSA-N |
| XLogP | 4.35 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|