C28H26BrF3N4O6 — CID 126181791
N'-[(Z)-[4-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-ethoxyphenyl)oxamide (PubChem CID 126181791) has the molecular formula C28H26BrF3N4O6 and a molecular weight of 651.44 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-ethoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-ethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126181791 |
| Molecular Formula | C28H26BrF3N4O6 |
| Molecular Weight | 651.44 g/mol |
| Exact Mass | 650.10 |
| IUPAC Name | N'-[(Z)-[4-[2-[4-bromo-2-(trifluoromethyl)anilino]-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-ethoxyphenyl)oxamide |
| SMILES | CCOc1ccccc1NC(=O)C(=O)N/N=C\c1ccc(OCC(=O)Nc2ccc(Br)cc2C(F)(F)F)c(OCC)c1 |
| InChI | InChI=1S/C28H26BrF3N4O6/c1-3-40-22-8-6-5-7-21(22)35-26(38)27(39)36-33-15-17-9-12-23(24(13-17)41-4-2)42-16-25(37)34-20-11-10-18(29)14-19(20)28(30,31)32/h5-15H,3-4,16H2,1-2H3,(H,34,37)(H,35,38)(H,36,39)/b33-15- |
| InChIKey | RZWHPLSIMCKTTR-UHIZKJEFSA-N |
| XLogP | 5.37 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|