C27H27BrN4O5 — CID 126179827
N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-ethylphenyl)oxamide (PubChem CID 126179827) has the molecular formula C27H27BrN4O5 and a molecular weight of 567.44 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-ethylphenyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-ethylphenyl)oxamide |
|---|---|
| PubChem CID | 126179827 |
| Molecular Formula | C27H27BrN4O5 |
| Molecular Weight | 567.44 g/mol |
| Exact Mass | 566.12 |
| IUPAC Name | N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-ethylphenyl)oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)Nc2ccccc2CC)ccc1OCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C27H27BrN4O5/c1-3-19-7-5-6-8-22(19)31-26(34)27(35)32-29-16-18-9-14-23(24(15-18)36-4-2)37-17-25(33)30-21-12-10-20(28)11-13-21/h5-16H,3-4,17H2,1-2H3,(H,30,33)(H,31,34)(H,32,35)/b29-16- |
| InChIKey | JRKFEBLKPPACRG-MWLSYYOVSA-N |
| XLogP | 4.52 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|