C29H27F3N4O6 — CID 126157970
N'-[(Z)-[3-ethoxy-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide (PubChem CID 126157970) has the molecular formula C29H27F3N4O6 and a molecular weight of 584.55 g/mol. Its IUPAC name is N'-[(Z)-[3-ethoxy-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[3-ethoxy-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126157970 |
| Molecular Formula | C29H27F3N4O6 |
| Molecular Weight | 584.55 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | N'-[(Z)-[3-ethoxy-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide |
| SMILES | C=CCOc1ccc(NC(=O)C(=O)N/N=C\c2ccc(OCC(=O)Nc3ccccc3C(F)(F)F)c(OCC)c2)cc1 |
| InChI | InChI=1S/C29H27F3N4O6/c1-3-15-41-21-12-10-20(11-13-21)34-27(38)28(39)36-33-17-19-9-14-24(25(16-19)40-4-2)42-18-26(37)35-23-8-6-5-7-22(23)29(30,31)32/h3,5-14,16-17H,1,4,15,18H2,2H3,(H,34,38)(H,35,37)(H,36,39)/b33-17- |
| InChIKey | IPMGKYPJLFSNSZ-FZPRHHONSA-N |
| XLogP | 4.78 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|