C30H34N4O7 — CID 126181039
N'-[(Z)-[3-ethoxy-4-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide (PubChem CID 126181039) has the molecular formula C30H34N4O7 and a molecular weight of 562.62 g/mol. Its IUPAC name is N'-[(Z)-[3-ethoxy-4-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[3-ethoxy-4-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126181039 |
| Molecular Formula | C30H34N4O7 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | N'-[(Z)-[3-ethoxy-4-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide |
| SMILES | CCCOc1ccc(NC(=O)C(=O)N/N=C\c2ccc(OCC(=O)Nc3ccc(OCC)cc3)c(OCC)c2)cc1 |
| InChI | InChI=1S/C30H34N4O7/c1-4-17-40-25-14-10-23(11-15-25)33-29(36)30(37)34-31-19-21-7-16-26(27(18-21)39-6-3)41-20-28(35)32-22-8-12-24(13-9-22)38-5-2/h7-16,18-19H,4-6,17,20H2,1-3H3,(H,32,35)(H,33,36)(H,34,37)/b31-19- |
| InChIKey | OPRQFVPNULCECT-DXJNIWACSA-N |
| XLogP | 4.38 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|