C27H28N4O6 — CID 126180410
N'-[(Z)-[4-[2-(4-ethoxyanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(4-methylphenyl)oxamide (PubChem CID 126180410) has the molecular formula C27H28N4O6 and a molecular weight of 504.54 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(4-ethoxyanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(4-methylphenyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-(4-ethoxyanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 126180410 |
| Molecular Formula | C27H28N4O6 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | N'-[(Z)-[4-[2-(4-ethoxyanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(4-methylphenyl)oxamide |
| SMILES | CCOc1ccc(NC(=O)COc2ccc(/C=N\NC(=O)C(=O)Nc3ccc(C)cc3)cc2OC)cc1 |
| InChI | InChI=1S/C27H28N4O6/c1-4-36-22-12-10-20(11-13-22)29-25(32)17-37-23-14-7-19(15-24(23)35-3)16-28-31-27(34)26(33)30-21-8-5-18(2)6-9-21/h5-16H,4,17H2,1-3H3,(H,29,32)(H,30,33)(H,31,34)/b28-16- |
| InChIKey | LLAGWACJKNZIND-NTFVMDSBSA-N |
| XLogP | 3.51 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|