C21H24ClN3O4 — CID 8931666
N-(4-butoxyphenyl)-N'-[(Z)-(3-chloro-4-ethoxyphenyl)methylideneamino]oxamide (PubChem CID 8931666) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-N'-[(Z)-(3-chloro-4-ethoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(4-butoxyphenyl)-N'-[(Z)-(3-chloro-4-ethoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 8931666 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-(4-butoxyphenyl)-N'-[(Z)-(3-chloro-4-ethoxyphenyl)methylideneamino]oxamide |
| SMILES | CCCCOc1ccc(NC(=O)C(=O)N/N=C\c2ccc(OCC)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H24ClN3O4/c1-3-5-12-29-17-9-7-16(8-10-17)24-20(26)21(27)25-23-14-15-6-11-19(28-4-2)18(22)13-15/h6-11,13-14H,3-5,12H2,1-2H3,(H,24,26)(H,25,27)/b23-14- |
| InChIKey | RVGJBEWBGCZBJY-UCQKPKSFSA-N |
| XLogP | 4.01 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|