C20H22ClN3O5 — CID 137079063
N-(4-butoxyphenyl)-N'-[(Z)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]oxamide (PubChem CID 137079063) has the molecular formula C20H22ClN3O5 and a molecular weight of 419.87 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-N'-[(Z)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(4-butoxyphenyl)-N'-[(Z)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 137079063 |
| Molecular Formula | C20H22ClN3O5 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-(4-butoxyphenyl)-N'-[(Z)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]oxamide |
| SMILES | CCCCOc1ccc(NC(=O)C(=O)N/N=C\c2cc(Cl)c(O)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H22ClN3O5/c1-3-4-9-29-15-7-5-14(6-8-15)23-19(26)20(27)24-22-12-13-10-16(21)18(25)17(11-13)28-2/h5-8,10-12,25H,3-4,9H2,1-2H3,(H,23,26)(H,24,27)/b22-12- |
| InChIKey | JAQHLGZEFOFKDI-UUYOSTAYSA-N |
| XLogP | 3.32 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|