C29H30N4O6 — CID 126263759
N'-[(Z)-[4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide (PubChem CID 126263759) has the molecular formula C29H30N4O6 and a molecular weight of 530.58 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126263759 |
| Molecular Formula | C29H30N4O6 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | N'-[(Z)-[4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide |
| SMILES | C=CCOc1ccc(NC(=O)C(=O)N/N=C\c2ccc(OCC(=O)Nc3cccc(C)c3C)c(OC)c2)cc1 |
| InChI | InChI=1S/C29H30N4O6/c1-5-15-38-23-12-10-22(11-13-23)31-28(35)29(36)33-30-17-21-9-14-25(26(16-21)37-4)39-18-27(34)32-24-8-6-7-19(2)20(24)3/h5-14,16-17H,1,15,18H2,2-4H3,(H,31,35)(H,32,34)(H,33,36)/b30-17- |
| InChIKey | QWIXOXGHJUFDJH-LQNQUEJISA-N |
| XLogP | 3.98 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|