C17H20BrN3O4 — CID 8989357
N'-[(Z)-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-N-cyclopropyloxamide (PubChem CID 8989357) has the molecular formula C17H20BrN3O4 and a molecular weight of 410.27 g/mol. Its IUPAC name is N'-[(Z)-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-N-cyclopropyloxamide.
| Compound Name | N'-[(Z)-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-N-cyclopropyloxamide |
|---|---|
| PubChem CID | 8989357 |
| Molecular Formula | C17H20BrN3O4 |
| Molecular Weight | 410.27 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | N'-[(Z)-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-N-cyclopropyloxamide |
| SMILES | C=CCOc1c(Br)cc(/C=N\NC(=O)C(=O)NC2CC2)cc1OCC |
| InChI | InChI=1S/C17H20BrN3O4/c1-3-7-25-15-13(18)8-11(9-14(15)24-4-2)10-19-21-17(23)16(22)20-12-5-6-12/h3,8-10,12H,1,4-7H2,2H3,(H,20,22)(H,21,23)/b19-10- |
| InChIKey | BLHPBVVXIWZXSC-GRSHGNNSSA-N |
| XLogP | 2.14 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|