C22H25ClIN3O4 — CID 4544103
N-(3-chloro-4-methylphenyl)-N'-[(3-ethoxy-5-iodo-4-propoxyphenyl)methylideneamino]propanediamide (PubChem CID 4544103) has the molecular formula C22H25ClIN3O4 and a molecular weight of 557.82 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-N'-[(3-ethoxy-5-iodo-4-propoxyphenyl)methylideneamino]propanediamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-N'-[(3-ethoxy-5-iodo-4-propoxyphenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 4544103 |
| Molecular Formula | C22H25ClIN3O4 |
| Molecular Weight | 557.82 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-N'-[(3-ethoxy-5-iodo-4-propoxyphenyl)methylideneamino]propanediamide |
| SMILES | CCCOc1c(I)cc(C=NNC(=O)CC(=O)Nc2ccc(C)c(Cl)c2)cc1OCC |
| InChI | InChI=1S/C22H25ClIN3O4/c1-4-8-31-22-18(24)9-15(10-19(22)30-5-2)13-25-27-21(29)12-20(28)26-16-7-6-14(3)17(23)11-16/h6-7,9-11,13H,4-5,8,12H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | ZJIADTFLGJHAFO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.82 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|