C22H24Cl2IN3O4 — CID 4553619
3,4-dichloro-N-[3-[2-[(3-ethoxy-5-iodo-4-propoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]benzamide (PubChem CID 4553619) has the molecular formula C22H24Cl2IN3O4 and a molecular weight of 592.26 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-[2-[(3-ethoxy-5-iodo-4-propoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-[2-[(3-ethoxy-5-iodo-4-propoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 4553619 |
| Molecular Formula | C22H24Cl2IN3O4 |
| Molecular Weight | 592.26 g/mol |
| Exact Mass | 591.02 |
| IUPAC Name | 3,4-dichloro-N-[3-[2-[(3-ethoxy-5-iodo-4-propoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]benzamide |
| SMILES | CCCOc1c(I)cc(C=NNC(=O)CCNC(=O)c2ccc(Cl)c(Cl)c2)cc1OCC |
| InChI | InChI=1S/C22H24Cl2IN3O4/c1-3-9-32-21-18(25)10-14(11-19(21)31-4-2)13-27-28-20(29)7-8-26-22(30)15-5-6-16(23)17(24)12-15/h5-6,10-13H,3-4,7-9H2,1-2H3,(H,26,30)(H,28,29) |
| InChIKey | SHVHMMINRFRXJM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.26 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|