C21H22BrCl2N3O3 — CID 3887697
N-[3-[2-[(5-bromo-2-butoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]-3,4-dichlorobenzamide (PubChem CID 3887697) has the molecular formula C21H22BrCl2N3O3 and a molecular weight of 515.24 g/mol. Its IUPAC name is N-[3-[2-[(5-bromo-2-butoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]-3,4-dichlorobenzamide.
| Compound Name | N-[3-[2-[(5-bromo-2-butoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 3887697 |
| Molecular Formula | C21H22BrCl2N3O3 |
| Molecular Weight | 515.24 g/mol |
| Exact Mass | 513.02 |
| IUPAC Name | N-[3-[2-[(5-bromo-2-butoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]-3,4-dichlorobenzamide |
| SMILES | CCCCOc1ccc(Br)cc1C=NNC(=O)CCNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H22BrCl2N3O3/c1-2-3-10-30-19-7-5-16(22)11-15(19)13-26-27-20(28)8-9-25-21(29)14-4-6-17(23)18(24)12-14/h4-7,11-13H,2-3,8-10H2,1H3,(H,25,29)(H,27,28) |
| InChIKey | DEPZPMMWHFRBDK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.24 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|