C22H26BrN3O3 — CID 3341360
N'-[(5-bromo-2-butoxyphenyl)methylideneamino]-N-(2-methylphenyl)butanediamide (PubChem CID 3341360) has the molecular formula C22H26BrN3O3 and a molecular weight of 460.37 g/mol. Its IUPAC name is N'-[(5-bromo-2-butoxyphenyl)methylideneamino]-N-(2-methylphenyl)butanediamide.
| Compound Name | N'-[(5-bromo-2-butoxyphenyl)methylideneamino]-N-(2-methylphenyl)butanediamide |
|---|---|
| PubChem CID | 3341360 |
| Molecular Formula | C22H26BrN3O3 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | N'-[(5-bromo-2-butoxyphenyl)methylideneamino]-N-(2-methylphenyl)butanediamide |
| SMILES | CCCCOc1ccc(Br)cc1C=NNC(=O)CCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C22H26BrN3O3/c1-3-4-13-29-20-10-9-18(23)14-17(20)15-24-26-22(28)12-11-21(27)25-19-8-6-5-7-16(19)2/h5-10,14-15H,3-4,11-13H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | XYJIXOZGZOZRIT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|