C19H19Br2N3O3 — CID 51061124
3-bromo-N-[2-[(2E)-2-[(5-bromo-2-propoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 51061124) has the molecular formula C19H19Br2N3O3 and a molecular weight of 497.19 g/mol. Its IUPAC name is 3-bromo-N-[2-[(2E)-2-[(5-bromo-2-propoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 3-bromo-N-[2-[(2E)-2-[(5-bromo-2-propoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 51061124 |
| Molecular Formula | C19H19Br2N3O3 |
| Molecular Weight | 497.19 g/mol |
| Exact Mass | 494.98 |
| IUPAC Name | 3-bromo-N-[2-[(2E)-2-[(5-bromo-2-propoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | CCCOc1ccc(Br)cc1/C=N/NC(=O)CNC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H19Br2N3O3/c1-2-8-27-17-7-6-16(21)10-14(17)11-23-24-18(25)12-22-19(26)13-4-3-5-15(20)9-13/h3-7,9-11H,2,8,12H2,1H3,(H,22,26)(H,24,25)/b23-11+ |
| InChIKey | DTLKRGJLVSADSD-FOKLQQMPSA-N |
| XLogP | 3.88 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.19 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|