C18H16BrCl2N3O4 — CID 135613435
N-[3-[(2E)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]-3,4-dichlorobenzamide (PubChem CID 135613435) has the molecular formula C18H16BrCl2N3O4 and a molecular weight of 489.15 g/mol. Its IUPAC name is N-[3-[(2E)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]-3,4-dichlorobenzamide.
| Compound Name | N-[3-[(2E)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 135613435 |
| Molecular Formula | C18H16BrCl2N3O4 |
| Molecular Weight | 489.15 g/mol |
| Exact Mass | 486.97 |
| IUPAC Name | N-[3-[(2E)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]-3,4-dichlorobenzamide |
| SMILES | COc1cc(Br)cc(/C=N/NC(=O)CCNC(=O)c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C18H16BrCl2N3O4/c1-28-15-8-12(19)6-11(17(15)26)9-23-24-16(25)4-5-22-18(27)10-2-3-13(20)14(21)7-10/h2-3,6-9,26H,4-5H2,1H3,(H,22,27)(H,24,25)/b23-9+ |
| InChIKey | HBTZKMDZSRHNAT-NUGSKGIGSA-N |
| XLogP | 3.74 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.15 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|