C21H19Cl2N3O4 — CID 4566838
3,4-dichloro-N-[3-[2-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]benzamide (PubChem CID 4566838) has the molecular formula C21H19Cl2N3O4 and a molecular weight of 448.31 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-[2-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-[2-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 4566838 |
| Molecular Formula | C21H19Cl2N3O4 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 3,4-dichloro-N-[3-[2-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]benzamide |
| SMILES | C#CCOc1ccc(C=NNC(=O)CCNC(=O)c2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C21H19Cl2N3O4/c1-3-10-30-18-7-4-14(11-19(18)29-2)13-25-26-20(27)8-9-24-21(28)15-5-6-16(22)17(23)12-15/h1,4-7,11-13H,8-10H2,2H3,(H,24,28)(H,26,27) |
| InChIKey | ABKUIGHZBIWPKI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|