C27H25Cl2FN4O5 — CID 3895696
3,4-dichloro-N-[3-[2-[[3-ethoxy-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]-3-oxopropyl]benzamide (PubChem CID 3895696) has the molecular formula C27H25Cl2FN4O5 and a molecular weight of 575.42 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-[2-[[3-ethoxy-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]-3-oxopropyl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-[2-[[3-ethoxy-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 3895696 |
| Molecular Formula | C27H25Cl2FN4O5 |
| Molecular Weight | 575.42 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | 3,4-dichloro-N-[3-[2-[[3-ethoxy-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]-3-oxopropyl]benzamide |
| SMILES | CCOc1cc(C=NNC(=O)CCNC(=O)c2ccc(Cl)c(Cl)c2)ccc1OCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C27H25Cl2FN4O5/c1-2-38-24-13-17(7-10-23(24)39-16-26(36)33-22-6-4-3-5-21(22)30)15-32-34-25(35)11-12-31-27(37)18-8-9-19(28)20(29)14-18/h3-10,13-15H,2,11-12,16H2,1H3,(H,31,37)(H,33,36)(H,34,35) |
| InChIKey | FQXMPRVMYFRQJJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|