C30H31FN4O7 — CID 4222170
ethyl 4-[[2-[2-ethoxy-4-[[[4-(2-fluoroanilino)-4-oxobutanoyl]hydrazinylidene]methyl]phenoxy]acetyl]amino]benzoate (PubChem CID 4222170) has the molecular formula C30H31FN4O7 and a molecular weight of 578.60 g/mol. Its IUPAC name is ethyl 4-[[2-[2-ethoxy-4-[[[4-(2-fluoroanilino)-4-oxobutanoyl]hydrazinylidene]methyl]phenoxy]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[2-ethoxy-4-[[[4-(2-fluoroanilino)-4-oxobutanoyl]hydrazinylidene]methyl]phenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 4222170 |
| Molecular Formula | C30H31FN4O7 |
| Molecular Weight | 578.60 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | ethyl 4-[[2-[2-ethoxy-4-[[[4-(2-fluoroanilino)-4-oxobutanoyl]hydrazinylidene]methyl]phenoxy]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2ccc(C=NNC(=O)CCC(=O)Nc3ccccc3F)cc2OCC)cc1 |
| InChI | InChI=1S/C30H31FN4O7/c1-3-40-26-17-20(18-32-35-28(37)16-15-27(36)34-24-8-6-5-7-23(24)31)9-14-25(26)42-19-29(38)33-22-12-10-21(11-13-22)30(39)41-4-2/h5-14,17-18H,3-4,15-16,19H2,1-2H3,(H,33,38)(H,34,36)(H,35,37) |
| InChIKey | QNAREQDCBRURJI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|