C27H25FN4O4 — CID 4989945
N'-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-fluorophenyl)butanediamide (PubChem CID 4989945) has the molecular formula C27H25FN4O4 and a molecular weight of 488.52 g/mol. Its IUPAC name is N'-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-fluorophenyl)butanediamide.
| Compound Name | N'-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-fluorophenyl)butanediamide |
|---|---|
| PubChem CID | 4989945 |
| Molecular Formula | C27H25FN4O4 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N'-[[4-[(2-cyanophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-fluorophenyl)butanediamide |
| SMILES | CCOc1cc(C=NNC(=O)CCC(=O)Nc2ccccc2F)ccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C27H25FN4O4/c1-2-35-25-15-19(11-12-24(25)36-18-21-8-4-3-7-20(21)16-29)17-30-32-27(34)14-13-26(33)31-23-10-6-5-9-22(23)28/h3-12,15,17H,2,13-14,18H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | SIEHZCYRPMDSDS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|