C20H22FN3O4 — CID 8930776
N'-[(Z)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-N-ethyloxamide (PubChem CID 8930776) has the molecular formula C20H22FN3O4 and a molecular weight of 387.41 g/mol. Its IUPAC name is N'-[(Z)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-N-ethyloxamide.
| Compound Name | N'-[(Z)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-N-ethyloxamide |
|---|---|
| PubChem CID | 8930776 |
| Molecular Formula | C20H22FN3O4 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N'-[(Z)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-N-ethyloxamide |
| SMILES | CCNC(=O)C(=O)N/N=C\c1ccc(OCc2ccccc2F)c(OCC)c1 |
| InChI | InChI=1S/C20H22FN3O4/c1-3-22-19(25)20(26)24-23-12-14-9-10-17(18(11-14)27-4-2)28-13-15-7-5-6-8-16(15)21/h5-12H,3-4,13H2,1-2H3,(H,22,25)(H,24,26)/b23-12- |
| InChIKey | HZXAWFBQOOCTQC-FMCGGJTJSA-N |
| XLogP | 2.39 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|