C25H22F4N2O3 — CID 21209432
N-[(E)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 21209432) has the molecular formula C25H22F4N2O3 and a molecular weight of 474.45 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(E)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 21209432 |
| Molecular Formula | C25H22F4N2O3 |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | N-[(E)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)Cc2cccc(C(F)(F)F)c2)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C25H22F4N2O3/c1-2-33-23-13-18(10-11-22(23)34-16-19-7-3-4-9-21(19)26)15-30-31-24(32)14-17-6-5-8-20(12-17)25(27,28)29/h3-13,15H,2,14,16H2,1H3,(H,31,32)/b30-15+ |
| InChIKey | MSTRHJAAKPFVBR-FJEPWZHXSA-N |
| XLogP | 5.51 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|