C29H26FN3O4 — CID 3904306
N'-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-N-(2-fluorophenyl)propanediamide (PubChem CID 3904306) has the molecular formula C29H26FN3O4 and a molecular weight of 499.54 g/mol. Its IUPAC name is N'-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-N-(2-fluorophenyl)propanediamide.
| Compound Name | N'-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-N-(2-fluorophenyl)propanediamide |
|---|---|
| PubChem CID | 3904306 |
| Molecular Formula | C29H26FN3O4 |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N'-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-N-(2-fluorophenyl)propanediamide |
| SMILES | CCOc1cc(C=NNC(=O)CC(=O)Nc2ccccc2F)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C29H26FN3O4/c1-2-36-27-16-20(18-31-33-29(35)17-28(34)32-25-13-6-5-12-24(25)30)14-15-26(27)37-19-22-10-7-9-21-8-3-4-11-23(21)22/h3-16,18H,2,17,19H2,1H3,(H,32,34)(H,33,35) |
| InChIKey | GOSYIQMZTNFAFO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|