C21H24FN3O4 — CID 5040782
N'-[(3-ethoxy-4-propoxyphenyl)methylideneamino]-N-(2-fluorophenyl)propanediamide (PubChem CID 5040782) has the molecular formula C21H24FN3O4 and a molecular weight of 401.44 g/mol. Its IUPAC name is N'-[(3-ethoxy-4-propoxyphenyl)methylideneamino]-N-(2-fluorophenyl)propanediamide.
| Compound Name | N'-[(3-ethoxy-4-propoxyphenyl)methylideneamino]-N-(2-fluorophenyl)propanediamide |
|---|---|
| PubChem CID | 5040782 |
| Molecular Formula | C21H24FN3O4 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N'-[(3-ethoxy-4-propoxyphenyl)methylideneamino]-N-(2-fluorophenyl)propanediamide |
| SMILES | CCCOc1ccc(C=NNC(=O)CC(=O)Nc2ccccc2F)cc1OCC |
| InChI | InChI=1S/C21H24FN3O4/c1-3-11-29-18-10-9-15(12-19(18)28-4-2)14-23-25-21(27)13-20(26)24-17-8-6-5-7-16(17)22/h5-10,12,14H,3-4,11,13H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | LHAIBYBAXLMGKM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|