C20H19F3N2O5 — CID 21209460
2-[2-ethoxy-4-[(E)-[[2-[3-(trifluoromethyl)phenyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 21209460) has the molecular formula C20H19F3N2O5 and a molecular weight of 424.38 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(E)-[[2-[3-(trifluoromethyl)phenyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-4-[(E)-[[2-[3-(trifluoromethyl)phenyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 21209460 |
| Molecular Formula | C20H19F3N2O5 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2-[2-ethoxy-4-[(E)-[[2-[3-(trifluoromethyl)phenyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(/C=N/NC(=O)Cc2cccc(C(F)(F)F)c2)ccc1OCC(=O)O |
| InChI | InChI=1S/C20H19F3N2O5/c1-2-29-17-9-14(6-7-16(17)30-12-19(27)28)11-24-25-18(26)10-13-4-3-5-15(8-13)20(21,22)23/h3-9,11H,2,10,12H2,1H3,(H,25,26)(H,27,28)/b24-11+ |
| InChIKey | KCHKXRXIACPJGR-BHGWPJFGSA-N |
| XLogP | 3.26 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|