C35H36F3N3O4 — CID 126019401
N-[(E)-[4-[2-[4-(1-adamantyl)anilino]-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 126019401) has the molecular formula C35H36F3N3O4 and a molecular weight of 619.68 g/mol. Its IUPAC name is N-[(E)-[4-[2-[4-(1-adamantyl)anilino]-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(E)-[4-[2-[4-(1-adamantyl)anilino]-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 126019401 |
| Molecular Formula | C35H36F3N3O4 |
| Molecular Weight | 619.68 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | N-[(E)-[4-[2-[4-(1-adamantyl)anilino]-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cc2cccc(C(F)(F)F)c2)ccc1OCC(=O)Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C35H36F3N3O4/c1-44-31-15-23(20-39-41-32(42)16-22-3-2-4-28(14-22)35(36,37)38)5-10-30(31)45-21-33(43)40-29-8-6-27(7-9-29)34-17-24-11-25(18-34)13-26(12-24)19-34/h2-10,14-15,20,24-26H,11-13,16-19,21H2,1H3,(H,40,43)(H,41,42)/b39-20+ |
| InChIKey | LBNFFUNAVVKYTH-JOXMEQDKSA-N |
| XLogP | 6.89 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.68 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|