C35H38BrN3O5 — CID 126026631
N-[(Z)-[4-[2-[4-(1-adamantyl)anilino]-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-5-bromo-2-methoxybenzamide (PubChem CID 126026631) has the molecular formula C35H38BrN3O5 and a molecular weight of 660.61 g/mol. Its IUPAC name is N-[(Z)-[4-[2-[4-(1-adamantyl)anilino]-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-5-bromo-2-methoxybenzamide.
| Compound Name | N-[(Z)-[4-[2-[4-(1-adamantyl)anilino]-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-5-bromo-2-methoxybenzamide |
|---|---|
| PubChem CID | 126026631 |
| Molecular Formula | C35H38BrN3O5 |
| Molecular Weight | 660.61 g/mol |
| Exact Mass | 659.20 |
| IUPAC Name | N-[(Z)-[4-[2-[4-(1-adamantyl)anilino]-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-5-bromo-2-methoxybenzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2cc(Br)ccc2OC)ccc1OCC(=O)Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C35H38BrN3O5/c1-3-43-32-15-22(20-37-39-34(41)29-16-27(36)7-11-30(29)42-2)4-10-31(32)44-21-33(40)38-28-8-5-26(6-9-28)35-17-23-12-24(18-35)14-25(13-23)19-35/h4-11,15-16,20,23-25H,3,12-14,17-19,21H2,1-2H3,(H,38,40)(H,39,41)/b37-20- |
| InChIKey | LQPUPTZGLNNDSY-CLHYIUPASA-N |
| XLogP | 7.11 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.61 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|