C25H23Br2N3O5 — CID 126027487
3,5-dibromo-N-[(Z)-[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-hydroxybenzamide (PubChem CID 126027487) has the molecular formula C25H23Br2N3O5 and a molecular weight of 605.28 g/mol. Its IUPAC name is 3,5-dibromo-N-[(Z)-[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-hydroxybenzamide.
| Compound Name | 3,5-dibromo-N-[(Z)-[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 126027487 |
| Molecular Formula | C25H23Br2N3O5 |
| Molecular Weight | 605.28 g/mol |
| Exact Mass | 603.00 |
| IUPAC Name | 3,5-dibromo-N-[(Z)-[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-hydroxybenzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2cc(Br)cc(Br)c2O)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C25H23Br2N3O5/c1-3-34-22-10-16(13-28-30-25(33)19-11-17(26)12-20(27)24(19)32)6-9-21(22)35-14-23(31)29-18-7-4-15(2)5-8-18/h4-13,32H,3,14H2,1-2H3,(H,29,31)(H,30,33)/b28-13- |
| InChIKey | VLFCQVKBRFXRAB-QDTIIGTASA-N |
| XLogP | 5.41 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.28 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|